CAS 16691-79-5: Bismethoxycarbonyldiphenylcyclopentadienone
Description:Bismethoxycarbonyldiphenylcyclopentadienone, with the CAS number 16691-79-5, is an organic compound characterized by its complex structure, which includes a cyclopentadienone moiety and methoxycarbonyl groups. This compound typically exhibits a yellow to orange coloration, indicative of its conjugated system, which can absorb visible light. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pigments due to its chromophoric properties. The presence of methoxy groups enhances its solubility in organic solvents, making it easier to handle in laboratory settings. Additionally, the compound may exhibit interesting reactivity patterns, including electrophilic aromatic substitution and coordination chemistry, owing to the presence of both carbonyl and aromatic functionalities. Its stability and reactivity can be influenced by environmental factors such as temperature and light exposure. As with many organic compounds, proper safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C21H16O5
InChI:InChI=1/C21H16O5/c1-25-20(23)17-15(13-9-5-3-6-10-13)16(14-11-7-4-8-12-14)18(19(17)22)21(24)26-2/h3-12H,1-2H3
- Synonyms:
- 2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone
- Dimethyl 2-Oxo-4,5-Diphenylcyclopenta-3,5-Diene-1,3-Dicarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,5-Cyclopentadiene-1,3-dicarboxylic acid, 2-oxo-4,5-diphenyl-, dimethyl ester REF: IN-DA001X0RCAS: 16691-79-5 | 95% | 52.00 €~265.00 € | Thu 17 Apr 25 |
![]() | 2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone REF: 3B-B1962CAS: 16691-79-5 | min. 96.0 area%(HPLC) | 123.00 €~431.00 € | Tue 22 Apr 25 |
![]() | 2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone REF: 3D-RAA69179CAS: 16691-79-5 | Min. 95% | - - - | Discontinued product |

3,5-Cyclopentadiene-1,3-dicarboxylic acid, 2-oxo-4,5-diphenyl-, dimethyl ester
Ref: IN-DA001X0R
1g | 129.00 € | ||
200mg | 52.00 € |

2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone
Ref: 3B-B1962
1g | 123.00 € | ||
5g | 431.00 € |

2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone
Ref: 3D-RAA69179
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |