CymitQuimica logo

CAS 16691-79-5

:

Bismethoxycarbonyldiphenylcyclopentadienone

Description:
Bismethoxycarbonyldiphenylcyclopentadienone, with the CAS number 16691-79-5, is an organic compound characterized by its complex structure, which includes a cyclopentadienone moiety and methoxycarbonyl groups. This compound typically exhibits a yellow to orange coloration, indicative of its conjugated system, which can absorb visible light. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pigments due to its chromophoric properties. The presence of methoxy groups enhances its solubility in organic solvents, making it easier to handle in laboratory settings. Additionally, the compound may exhibit interesting reactivity patterns, including electrophilic aromatic substitution and coordination chemistry, owing to the presence of both carbonyl and aromatic functionalities. Its stability and reactivity can be influenced by environmental factors such as temperature and light exposure. As with many organic compounds, proper safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C21H16O5
InChI:InChI=1/C21H16O5/c1-25-20(23)17-15(13-9-5-3-6-10-13)16(14-11-7-4-8-12-14)18(19(17)22)21(24)26-2/h3-12H,1-2H3
InChI key:NTXFYWYVVGMAGT-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(c2ccccc2)C(=C(C1=O)C(=O)OC)c1ccccc1
Synonyms:
  • 2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone
  • Dimethyl 2-Oxo-4,5-Diphenylcyclopenta-3,5-Diene-1,3-Dicarboxylate
Found 4 products.