CAS 166977-94-2

Methyl 4-[[(diethoxyphosphinyl)oxy]methyl]benzoate

Description:

Methyl 4-[[(diethoxyphosphinyl)oxy]methyl]benzoate, with CAS number 166977-94-2, is an organophosphorus compound characterized by its ester functional group and a phosphinyl moiety. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the benzoate structure, which can influence its solubility in organic solvents. The diethoxyphosphinyl group contributes to its potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in various chemical applications, including as a potential intermediate in the synthesis of more complex molecules. Additionally, the presence of the methyl ester can enhance its stability and affect its biological activity. The compound may also exhibit specific interactions with biological systems, which could be relevant in agricultural or pharmaceutical contexts. Safety and handling precautions should be observed, as organophosphorus compounds can exhibit toxicity depending on their structure and functional groups. Overall, Methyl 4-[[(diethoxyphosphinyl)oxy]methyl]benzoate is a versatile compound with potential applications in synthetic chemistry and beyond.

Formula: C₁₃H₁₉O₆P

InChI: InChI=1S/C13H19O6P/c1-4-17-20(15,18-5-2)19-10-11-6-8-12(9-7-11)13(14)16-3/h6-9H,4-5,10H2,1-3H3

InChI key: InChIKey=GMGFTZJUJJDYPI-UHFFFAOYSA-N

SMILES: P(OCC1=CC=C(C(OC)=O)C=C1)(OCC)(OCC)=O

Synonyms:

• Methyl 4-[[(diethoxyphosphinyl)oxy]methyl]benzoate
• Benzoic acid, 4-[[(diethoxyphosphinyl)oxy]methyl]-, methyl ester
• Methyl 4-(diethoxyphosphorylmethyl)benzoate

Benzoic acid, 4-[[(diethoxyphosphinyl)oxy]methyl]-, methyl ester

CAS: 166977-94-2

Formula: C₁₃H₁₉O₆P

Molecular weight: 302.2601

Ref: IN-DA001X2C