CAS 16700-55-3
:(2,6-dimethoxyphenyl)methanol
Description:
(2,6-Dimethoxyphenyl)methanol, with the CAS number 16700-55-3, is an organic compound characterized by its phenolic structure, which features a methanol group attached to a benzene ring that has two methoxy groups at the 2 and 6 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic character. The presence of methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions in various chemical environments. (2,6-Dimethoxyphenyl)methanol may exhibit biological activity, making it of interest in medicinal chemistry and research. Its synthesis often involves methods such as alkylation or reduction processes, and it can serve as a precursor for further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12O3
InChI:InChI=1/C9H12O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5,10H,6H2,1-2H3
SMILES:COc1cccc(c1CO)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-DIMETHOXYBENZYL ALCOHOL
CAS:Formula:C9H12O3Purity:97%Color and Shape:SolidMolecular weight:168.18982,6-Dimethoxybenzyl alcohol
CAS:2,6-Dimethoxybenzyl alcoholFormula:C9H12O3Purity:≥95%Color and Shape: white solidMolecular weight:168.19g/mol2,6-Dimethoxybenzyl alcohol
CAS:2,6-Dimethoxybenzyl alcohol is a synthetic compound that is a peroxidase substrate. It is used as an alternative for papaverine in the synthesis of penicillin and cephalosporin antibiotics. 2,6-Dimethoxybenzyl alcohol reacts with Mn2+ ions to form hydronium and hydrogen peroxide. This reaction has been shown to be more efficient than the decomposition of hydrogen peroxide by catalases or superoxide dismutases. 2,6-Dimethoxybenzyl alcohol also forms a reactive congener with erythrocytes and plasma proteins that can cause vasoconstriction in the blood vessels. The dimethoxybenzyl group (DMB) is a monosubstituted phenol group that binds to the active site of enzymes such as cytochrome P450s and glutathione reductase.
Formula:C9H12O3Purity:Min. 95%Molecular weight:168.19 g/mol(2,6-Dimethoxyphenyl)methanol
CAS:Formula:C9H12O3Purity:95%Color and Shape:SolidMolecular weight:168.192



