CymitQuimica logo

CAS 167096-99-3

:

benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate

Description:
Benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which features two hydroxyl (-OH) groups at the 3 and 4 positions, contributing to its potential as a chiral building block in organic synthesis. The presence of the benzyl group enhances its lipophilicity, which may influence its solubility and reactivity in various chemical environments. This compound is often studied for its biological activity, particularly in the context of medicinal chemistry, where its structural features may impart specific pharmacological properties. The stereochemistry indicated by the (3S,4R) configuration suggests that it exists as a specific enantiomer, which can be crucial for its interaction with biological targets. Additionally, the carboxylate functional group may participate in various chemical reactions, making it a versatile intermediate in synthetic pathways. Overall, benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate is of interest in both academic research and potential therapeutic applications.
Formula:C13H17NO4
InChI:InChI=1/C13H17NO4/c15-11-6-7-14(8-12(11)16)13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,15-16H,6-9H2/t11-,12+/m1/s1
Synonyms:
  • Benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.