CymitQuimica logo

CAS 167114-91-2

:

autocamtide-2-related inhibitory*peptide

Description:
Autocamtide-2-related inhibitory peptide (ACID) is a synthetic peptide that serves as a specific inhibitor of calcium/calmodulin-dependent protein kinase II (CaMKII). This peptide is derived from the autocamtide-2 sequence, which is a substrate for CaMKII, and it is designed to selectively inhibit the kinase's activity, thereby modulating various signaling pathways influenced by calcium ions. ACID is characterized by its ability to bind to the regulatory domain of CaMKII, preventing its activation and subsequent phosphorylation of target proteins. This inhibition plays a crucial role in research related to cardiac function, neuronal signaling, and various cellular processes where CaMKII is implicated. The CAS number 167114-91-2 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. As a research tool, ACID is valuable for studying the physiological and pathological roles of CaMKII in different biological contexts, contributing to our understanding of cellular signaling mechanisms.
Formula:C64H116N22O19
InChI:InChI=1S/C64H116N22O19/c1-31(2)28-43(83-50(92)34(7)75-54(96)38(17-11-13-25-66)78-53(95)37(67)16-10-12-24-65)60(102)80-40(19-15-27-74-64(71)72)56(98)79-39(18-14-26-73-63(69)70)57(99)81-41(20-22-46(68)87)58(100)82-42(21-23-47(88)89)55(97)76-36(9)52(94)86-49(33(5)6)61(103)84-44(30-48(90)91)59(101)77-35(8)51(93)85-45(62(104)105)29-32(3)4/h31-45,49H,10-30,65-67H2,1-9H3,(H2,68,87)(H,75,96)(H,76,97)(H,77,101)(H,78,95)(H,79,98)(H,80,102)(H,81,99)(H,82,100)(H,83,92)(H,84,103)(H,85,93)(H,86,94)(H,88,89)(H,90,91)(H,104,105)(H4,69,70,73)(H4,71,72,74)/t34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,49-/m0/s1
InChI key:USSJDGBHUQEJJG-HKDQSZHBSA-N
SMILES:C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)N
Synonyms:
  • H-Lys-Lys-Ala-Leu-Arg-Arg-Gln-Glu-Ala-Val-Asp-Ala-Leu-OH
  • Autocamtide-2 Related Inhibitory Peptide
Found 6 products.