CymitQuimica logo

CAS 16716-13-5

:

m-Quinquephenyl

Description:
m-Quinquephenyl, with the CAS number 16716-13-5, is a polyphenyl compound characterized by its unique structure, which consists of five phenyl rings connected in a linear arrangement. This compound exhibits notable thermal stability and is often studied for its potential applications in organic electronics and materials science. m-Quinquephenyl is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Its molecular structure contributes to interesting electronic properties, making it a subject of research in the field of organic semiconductors. Additionally, the compound may exhibit fluorescence, which can be advantageous in various optoelectronic applications. The synthesis of m-Quinquephenyl often involves coupling reactions, and its characterization can be performed using techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Overall, m-Quinquephenyl is a significant compound in the study of advanced materials, particularly in the development of new organic electronic devices.
Formula:C30H22
InChI:InChI=1S/C30H22/c1-3-10-23(11-4-1)25-14-7-16-27(20-25)29-18-9-19-30(22-29)28-17-8-15-26(21-28)24-12-5-2-6-13-24/h1-22H
InChI key:InChIKey=XQCZQOSQCGDDPQ-UHFFFAOYSA-N
SMILES:C1(=CC(=CC=C1)C2=CC(=CC=C2)C3=CC=CC=C3)C4=CC(=CC=C4)C5=CC=CC=C5
Synonyms:
  • 1,1′:3′,1′′:3′′,1′′′:3′′′,1′′′′-Quinquephenyl
  • m-Quinquephenyl
  • NSC 90722
  • m-Terphenyl, 3,3′′-diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.