CymitQuimica logo

CAS 16726-66-2

:

3-BROMO-NAPHTHALENE-1-CARBOXYLIC ACID

Description:
3-Bromo-naphthalene-1-carboxylic acid is an aromatic compound characterized by the presence of a naphthalene ring substituted with a bromine atom and a carboxylic acid functional group. The bromine substitution occurs at the 3-position of the naphthalene, while the carboxylic acid group is located at the 1-position. This compound is typically a solid at room temperature and exhibits properties common to aromatic carboxylic acids, such as acidity due to the carboxyl group. It is soluble in organic solvents and may have limited solubility in water. The presence of the bromine atom can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various derivatives through electrophilic substitution reactions. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and the potential for irritation.
Formula:C11H7BrO2
InChI:InChI=1S/C11H7BrO2/c12-8-5-7-3-1-2-4-9(7)10(6-8)11(13)14/h1-6H,(H,13,14)
InChI key:SBGVNBGHCCLMRR-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=C(C=C2C(=O)O)Br
Found 5 products.