CAS 1672691-74-5

4-(4-Morpholinyl)-1,2,5-thiadiazol-3-yl N-cyclooctyl-N-methylcarbamate

Description:

4-(4-Morpholinyl)-1,2,5-thiadiazol-3-yl N-cyclooctyl-N-methylcarbamate is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a carbamate functional group. The presence of the morpholine moiety contributes to its potential biological activity, as morpholines are often associated with various pharmacological properties. This compound is likely to exhibit moderate to high solubility in organic solvents due to its complex structure, while its solubility in water may vary depending on the specific substituents and their interactions. The thiadiazole ring can impart specific reactivity and stability characteristics, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the cyclooctyl and methyl groups attached to the carbamate nitrogen may influence the compound's lipophilicity and overall biological interactions. As with many synthetic compounds, safety and handling precautions should be observed, and its environmental impact should be assessed in accordance with regulatory guidelines.

Formula: C₁₆H₂₆N₄O₃S

InChI: InChI=1S/C16H26N4O3S/c1-19(13-7-5-3-2-4-6-8-13)16(21)23-15-14(17-24-18-15)20-9-11-22-12-10-20/h13H,2-12H2,1H3

InChI key: WKSHMJCYWFOADB-UHFFFAOYSA-N

SMILES: CN(C1CCCCCCC1)C(=O)OC2=NSN=C2N3CCOCC3

Synonyms:

• 4-(4-Morpholinyl)-1,2,5-thiadiazol-3-yl N-cyclooctyl-N-methylcarbamate
• JZP-430
• Carbamic acid, N-cyclooctyl-N-methyl-, 4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl ester

JZP-430

CAS: 1672691-74-5

JZP-430 is an effective, highly selective, irreversible inhibitor of α/β-hydrolase domain 6 (ABHD6) (IC50: 44 nM).

Formula: C₁₆H₂₆N₄O₃S

Purity: 99.78%

Color and Shape: Solid

Molecular weight: 354.47

Ref: TM-T15635

JZP-430

CAS: 1672691-74-5

Formula: C₁₆H₂₆N₄O₃S

Purity: 99%

Molecular weight: 354.4676

Ref: IN-DA01ENKY

JZP-430

CAS: 1672691-74-5

JZP-430

Formula: C₁₆H₂₆N₄O₃S

Purity: ≥98%

Molecular weight: 354.47

Ref: 54-BUP08588

JZP-430

CAS: 1672691-74-5

4-Morpholino-1,2,5-thiadiazol-3-yl cyclooctyl(methyl)carbamate

Formula: C₁₆H₂₆N₄O₃S

Purity: 99%

Molecular weight: 354.47

Ref: IN-DG01115181

JZP 430

CAS: 1672691-74-5

JZP 430 is a pharmaceutical compound, which is synthesized in a laboratory setting with advanced techniques of medicinal chemistry. It functions as a modulator of specific neural pathways associated with sleep regulation. By targeting and interacting with specific neurotransmitter systems, JZP 430 aims to optimize the sleep-wake cycle, offering potential therapeutic benefits for sleep disorders. Its mode of action involves binding to neural receptors, enhancing sleep quality, and reducing the latency to sleep onset. The applications of JZP 430 are focused on treating conditions such as narcolepsy and idiopathic hypersomnia, where irregular sleep patterns significantly impact daily functioning. The compound is undergoing rigorous clinical evaluations to determine its efficacy and safety profile, aiming to fill the current therapeutic gaps in managing complex sleep disorders.

Formula: C₁₆H₂₆N₄O₃S

Purity: Min. 95%

Molecular weight: 354.5 g/mol

Ref: 3D-XRC69174