CAS 16727-30-3
:Malvidin 3,5-diglucoside
Description:
Malvidin 3,5-diglucoside is a naturally occurring anthocyanin, a type of flavonoid pigment found in various fruits, particularly in grapes and red wine. It is characterized by its deep red to purple color, which is responsible for the coloration in many berries and wine products. The compound is a glycoside, meaning it consists of a sugar moiety attached to an aglycone (the anthocyanin part), specifically malvidin, which contributes to its stability and solubility in water. Malvidin 3,5-diglucoside is known for its antioxidant properties, which can help protect cells from oxidative stress and may contribute to various health benefits associated with the consumption of fruits and red wine. The compound is sensitive to pH changes, which can affect its color and stability, making it an important factor in food science and technology. Additionally, it has been studied for its potential role in enhancing the sensory qualities of food and beverages, as well as its implications in health and nutrition.
Formula:C29H35O17·Cl
InChI:InChI=1S/C29H34O17.ClH/c1-40-15-3-10(4-16(41-2)20(15)33)27-17(44-29-26(39)24(37)22(35)19(9-31)46-29)7-12-13(42-27)5-11(32)6-14(12)43-28-25(38)23(36)21(34)18(8-30)45-28;/h3-7,18-19,21-26,28-31,34-39H,8-9H2,1-2H3,(H-,32,33);1H/t18-,19-,21-,22-,23+,24+,25-,26-,28-,29-;/m1./s1
InChI key:InChIKey=RHKJIVJBQJXLBY-FTIBDFQESA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=CC(O)=C2)C4=CC(OC)=C(O)C(OC)=C4)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,5-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride (1:1)
- 3,5-Bis(beta-D-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride
- 5-[(3xi)-beta-D-ribo-hexopyranosyloxy]-7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenium-3-yl beta-L-glucopyranoside chloride
- Malvidin 3,5-di-O-glucoside
- Malvidin 3,5-diglucoside
- Malvidol 3,5-diglucoside chloride
- Malvin
- Malvin chloride
- Malvoside
- Nsc 407312
- 1-Benzopyrylium, 3,5-bis(β-D-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Malvin chloride
CAS:Malvin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C29H35O17ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:691.01Malvidin-3,5-O-diglucoside chloride
CAS:<p>Malvidin-3,5-O-diglucoside chloride is an anthocyanin that can be isolated from Desmodium sandwicense and used in the study of inflammatory diseases.</p>Formula:C29H35ClO17Purity:98.7%Color and Shape:SolidMolecular weight:691.03Malvidin 3,5-diglucoside chloride
CAS:Natural glycosideFormula:C29H35O17ClPurity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:691.04Malvidin 3,5-diglucoside
CAS:<p>Malvidin 3,5-diglucoside is an anthocyanin pigment, which is a naturally occurring compound predominantly found in various fruits, flowers, and plants. It is derived primarily from grape skins, black rice, and other dark-colored fruit sources. As a glycoside, it consists of the anthocyanidin malvidin bound to two glucose molecules.</p>Formula:C29H35O17ClPurity:Min. 95%Color and Shape:Brown PowderMolecular weight:691.03 g/mol
