CAS 167412-36-4

4,6-Bis(6-2,2′-bipyridinyl)pyrimidine

Description:

4,6-Bis(6-2,2′-bipyridinyl)pyrimidine is a chemical compound characterized by its complex structure, which includes a pyrimidine core substituted with two 2,2'-bipyridine groups at the 4 and 6 positions. This compound is notable for its potential applications in coordination chemistry, particularly in the formation of metal complexes due to the presence of nitrogen donor atoms in the bipyridine moieties. It exhibits properties such as good solubility in organic solvents and the ability to participate in π-π stacking interactions, which can influence its behavior in various chemical environments. The compound may also display interesting photophysical properties, making it a candidate for studies in materials science and molecular electronics. Additionally, its structural features allow for the exploration of its reactivity and interactions with transition metals, which can lead to the development of novel catalysts or sensors. Overall, 4,6-Bis(6-2,2′-bipyridinyl)pyrimidine is a versatile compound with significant implications in both fundamental and applied chemistry.

Formula: C₂₄H₁₆N₆

InChI: InChI=1S/C24H16N6/c1-3-13-25-17(7-1)19-9-5-11-21(29-19)23-15-24(28-16-27-23)22-12-6-10-20(30-22)18-8-2-4-14-26-18/h1-16H

InChI key: InChIKey=YWDAHRHRZBYXOD-UHFFFAOYSA-N

SMILES: C=1(C=C(N=CN1)C=2N=C(C=CC2)C3=CC=CC=N3)C=4N=C(C=CC4)C5=CC=CC=N5

Synonyms:

• 4,6-Bis(6-2,2′-bipyridinyl)pyrimidine
• 4,6-Bis([2,2′-bipyridin]-6-yl)pyrimidine
• 4,6-Bis(2,2′-bipyridin-6-yl)pyrimidine
• Pyrimidine, 4,6-bis([2,2′-bipyridin]-6-yl)-

Pyrimidine, 4,6-bis([2,2'-bipyridin]-6-yl)-

CAS: 167412-36-4

Formula: C₂₄H₁₆N₆

Molecular weight: 388.424

Ref: IN-DA001XDI