CymitQuimica logo

CAS 167484-91-5

:

tert-butyl 5-fluorospiro[indoline-3,4'-piperidine]-1'-carboxylate

Description:
Tert-butyl 5-fluorospiro[indoline-3,4'-piperidine]-1'-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both indoline and piperidine moieties. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of a fluorine atom at the 5-position of the indoline ring enhances its biological activity and can influence its pharmacokinetic properties. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential applications in drug development, particularly in targeting specific biological pathways. The spiro structure often imparts rigidity, which can be beneficial for binding interactions with biological targets. Additionally, the tert-butyl group can provide steric hindrance, affecting the compound's overall reactivity and interaction with enzymes or receptors. Overall, tert-butyl 5-fluorospiro[indoline-3,4'-piperidine]-1'-carboxylate exemplifies a class of compounds that may exhibit significant therapeutic potential, warranting further investigation into its properties and applications.
Formula:C17H23FN2O2
InChI:InChI=1/C17H23FN2O2/c1-16(2,3)22-15(21)20-8-6-17(7-9-20)11-19-14-5-4-12(18)10-13(14)17/h4-5,10,19H,6-9,11H2,1-3H3
InChI key:MPZQIQHRSUIGMT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CNc1ccc(cc21)F
Found 4 products.