
CAS 167875-41-4
:Barceloneic acid B
Description:
Barceloneic acid B, with the CAS number 167875-41-4, is a chemical compound that belongs to a class of substances known for their potential biological activities. While specific details about its physical and chemical properties may not be widely documented, compounds in this category often exhibit characteristics such as being organic acids, which can influence their solubility, reactivity, and interaction with biological systems. Typically, such compounds may possess functional groups that contribute to their acidity and potential for forming hydrogen bonds. They may also show varying degrees of stability under different environmental conditions. Research into compounds like Barceloneic acid B often focuses on their potential applications in pharmaceuticals, agriculture, or biochemistry, particularly in relation to their effects on living organisms or their utility in synthetic processes. Further studies are essential to fully elucidate its properties, mechanisms of action, and potential uses in various fields.
Formula:C16H14O8
InChI:InChI=1S/C16H14O8/c1-7-3-10(17)13(16(21)22)12(4-7)24-14-9(15(19)20)5-8(23-2)6-11(14)18/h3-6,17-18H,1-2H3,(H,19,20)(H,21,22)
InChI key:InChIKey=BMKJMWKTRHWAPN-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C(O)=CC(C)=C1)C2=C(C(O)=O)C=C(OC)C=C2O
Synonyms:- 2-(2-Carboxy-3-hydroxy-5-methylphenoxy)-3-hydroxy-5-methoxybenzoic acid
- Barceloneic acid B
- Benzoic acid, 2-(2-carboxy-3-hydroxy-5-methylphenoxy)-3-hydroxy-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, 2-(2-carboxy-3-hydroxy-5-methylphenoxy)-3-hydroxy-5-methoxy-
CAS:Formula:C16H14O8Molecular weight:334.2776
