CAS 16794-13-1
:2-Methyl-2-propanesulfonic acid
Description:
2-Methyl-2-propanesulfonic acid, also known as neopentanesulfonic acid, is an organic sulfonic acid characterized by its branched structure, which includes a sulfonic acid group (-SO3H) attached to a neopentyl carbon skeleton. This compound is a colorless to pale yellow liquid at room temperature and is highly soluble in water due to the presence of the sulfonic acid group, which enhances its ionic character. It exhibits strong acidity, making it a useful reagent in various chemical reactions, particularly in organic synthesis and as a catalyst. The presence of the bulky methyl groups contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. 2-Methyl-2-propanesulfonic acid is also known for its stability under a range of conditions, which makes it suitable for use in various applications, including pharmaceuticals and as a buffer in biochemical assays. Safety precautions should be observed when handling this compound, as with many strong acids, to prevent skin and eye irritation.
Formula:C4H10O3S
InChI:InChI=1S/C4H10O3S/c1-4(2,3)8(5,6)7/h1-3H3,(H,5,6,7)
InChI key:InChIKey=XCJGLBWDZKLQCY-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)(C)(C)C
Synonyms:- NSC 23376
- 1,1-Dimethyl-1-ethanesulfonic acid
- 2-Propanesulfonic acid, 2-methyl-
- 2-Methyl-2-propanesulfonic acid
- tert-Butylsulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
