
CAS 1680-16-6
:N-[(2-Azido-1H-benzimidazol-1-yl)carbonyl]glycine butyl ester
Description:
N-[(2-Azido-1H-benzimidazol-1-yl)carbonyl]glycine butyl ester, with the CAS number 1680-16-6, is a chemical compound characterized by its unique structural features, including an azido group and a benzimidazole moiety. This compound typically exhibits properties associated with both the azido functional group, which is known for its reactivity and potential for click chemistry applications, and the benzimidazole ring, which often contributes to biological activity and stability. The butyl ester group enhances lipophilicity, potentially improving membrane permeability and bioavailability. In terms of solubility, compounds of this nature may be soluble in organic solvents but less so in water, depending on the specific substituents and their interactions. The presence of the carbonyl and amino groups suggests that it may participate in various chemical reactions, including amide bond formation and nucleophilic substitutions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block for more complex molecules.
Formula:C14H16N6O3
InChI:InChI=1S/C14H16N6O3/c1-2-3-8-23-12(21)9-16-14(22)20-11-7-5-4-6-10(11)17-13(20)18-19-15/h4-7H,2-3,8-9H2,1H3,(H,16,22)
InChI key:InChIKey=APKWSFXQFSKMEP-UHFFFAOYSA-N
SMILES:C(NCC(OCCCC)=O)(=O)N1C=2C(N=C1N=[N+]=[N-])=CC=CC2
Synonyms:- N-[(2-Azido-1H-benzimidazol-1-yl)carbonyl]glycine butyl ester
- Glycine, N-[(2-azido-1-benzimidazolyl)carbonyl]-, butyl ester
- Glycine, N-[(2-azido-1H-benzimidazol-1-yl)carbonyl]-, butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycine, N-[(2-azido-1H-benzimidazol-1-yl)carbonyl]-, butyl ester
CAS:Formula:C14H16N6O3Molecular weight:316.3152
