CAS 168123-79-3

Pyrido[2,3-b]pyrazine-2,3-dione, 7-chloro-1,4-dihydro-, 5-oxide

Description:

Pyrido[2,3-b]pyrazine-2,3-dione, 7-chloro-1,4-dihydro-, 5-oxide, with the CAS number 168123-79-3, is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings. This compound features a chlorine substituent at the 7-position and a 5-oxide functional group, which contributes to its reactivity and potential biological activity. The presence of the dione structure indicates that it contains two carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many heterocycles, it may exhibit interesting electronic properties due to the delocalization of electrons within the aromatic system. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₇H₄ClN₃O₃

InChI: InChI=1S/C7H4ClN3O3/c8-3-1-4-5(11(14)2-3)10-7(13)6(12)9-4/h1-2H,(H,9,12)(H,10,13)

InChI key: InChIKey=KCKQLSYPVKEZFW-UHFFFAOYSA-N

SMILES: O=N1=C2C(NC(=O)C(=O)N2)=CC(Cl)=C1

Synonyms:

• Pyrido[2,3-b]pyrazine-2,3-dione, 7-chloro-1,4-dihydro-, 5-oxide

Pyrido[2,3-b]pyrazine-2,3-dione, 7-chloro-1,4-dihydro-, 5-oxide

CAS: 168123-79-3

Formula: C₇H₄ClN₃O₃

Molecular weight: 213.578

Ref: IN-DA001XU1