CAS 16825-54-0
:4-pentadecylbenzene-1,3-diol
Description:
4-Pentadecylbenzene-1,3-diol, with the CAS number 16825-54-0, is an organic compound characterized by its long hydrophobic alkyl chain and two hydroxyl (-OH) groups positioned on a benzene ring. This structure imparts both hydrophobic and hydrophilic properties, making it amphiphilic. The presence of the pentadecyl group contributes to its potential applications in surfactants, emulsifiers, and as a lubricant due to its ability to reduce surface tension. The diol functionality allows for hydrogen bonding, which can enhance solubility in polar solvents and improve interactions with biological systems. Additionally, the compound may exhibit interesting thermal and phase behavior, which can be influenced by the length of the alkyl chain. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the balance between the hydrophobic alkyl chain and the hydrophilic hydroxyl groups. Overall, 4-pentadecylbenzene-1,3-diol is a versatile compound with potential applications in various fields, including materials science and biochemistry.
Formula:C21H36O2
InChI:InChI=1/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-17-20(22)18-21(19)23/h16-18,22-23H,2-15H2,1H3
SMILES:CCCCCCCCCCCCCCCc1ccc(cc1O)O
Synonyms:- 1,3-Benzenediol, 4-Pentadecyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Pentadecylresorcinol
CAS:Controlled ProductFormula:C21H36O2Color and Shape:NeatMolecular weight:320.509

