CAS 168397-51-1
:2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-BETA-D-GLUCOPYRANOSYL AZIDE
Description:
2-Acetamido-4,6-O-benzylidene-2-deoxy-beta-D-glucopyranosyl azide is a complex organic compound characterized by its azide functional group, which is known for its reactivity and utility in various chemical transformations, particularly in click chemistry. This compound features a glucopyranosyl moiety, indicating that it is a derivative of glucose, modified with an acetamido group and a benzylidene protecting group. The presence of the azide group suggests potential applications in bioconjugation and the synthesis of glycosylated compounds. Its structural features contribute to its solubility and stability in organic solvents, making it suitable for various synthetic applications. The compound's unique combination of functional groups allows for selective reactions, which can be exploited in medicinal chemistry and carbohydrate chemistry. As with many azides, it should be handled with care due to potential hazards associated with azide compounds, including sensitivity to heat and shock. Overall, this compound represents a valuable intermediate in the synthesis of more complex glycosylated molecules.
Formula:C15H18N4O5
InChI:InChI=1/C15H18N4O5/c1-8(20)17-11-12(21)13-10(23-14(11)18-19-16)7-22-15(24-13)9-5-3-2-4-6-9/h2-6,10-15,21H,7H2,1H3,(H,17,20)/t10-,11-,12-,13-,14-,15-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@H]2[C@@H](CO[C@@H](c3ccccc3)O2)O[C@H]1N=[N+]=[NH-])O)O
Synonyms:- N-[(2R,4aR,6R,7R,8R,8aS)-6-Azido-8-hydroxy-2-phenylhexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Acetamido-4,6-O-benzylidene-2-deoxy-β-D-glucopyranosyl Azide
CAS:2-Acetamido-4,6-O-benzylidene-2-deoxy-β-D-glucopyranosyl AzideFormula:C15H18N4O5Purity:>98.0%Molecular weight:334.33β-D-Glucopyranosyl azide, 2-(acetylamino)-2-deoxy-4,6-O-[(R)-phenylmethylene]-
CAS:Formula:C15H18N4O5Purity:98.0%Color and Shape:SolidMolecular weight:334.32722-Acetamido-4,6-O-benzylidene-2-deoxy-β-D-glucopyranosyl Azide
CAS:Formula:C15H18N4O5Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:334.332-Acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranosyl Azide
CAS:Controlled ProductApplications 2-Acetamido-4,6-O-benzylidene-2-deoxy-beta-D-glucopyranosyl Azide 168397-51-1 (cas# 168397-51-1) is a useful research chemical.
Formula:C15H18N4O5Color and Shape:NeatMolecular weight:334.332-Acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranosyl azide
CAS:2-Acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranosyl azide is a synthetic carbohydrate that has been modified with an azide group. This modification allows for the introduction of a variety of different functional groups to be incorporated into the carbohydrate. This synthetic carbohydrate can be used as a sugar or glycosylation acceptor in chemical synthesis, and it is soluble in water. The CAS number for this compound is 168397-51-1.
Formula:C15H18N4O5Purity:Min. 95%Molecular weight:334.33 g/mol





