CymitQuimica logo

CAS 16859-59-9

:

(3R)-3-hydroxy-2-benzofuran-1(3H)-one

Description:
(3R)-3-hydroxy-2-benzofuran-1(3H)-one, also known as 3-hydroxyflavone, is a chemical compound characterized by its benzofuran structure, which features a fused benzene and furan ring. This compound exhibits a hydroxyl group at the 3-position, contributing to its reactivity and potential biological activity. It is typically a yellow to orange crystalline solid, soluble in organic solvents but less so in water, reflecting its hydrophobic nature. The compound is known for its antioxidant properties and has been studied for various pharmacological effects, including anti-inflammatory and anticancer activities. Its structure allows for the possibility of forming hydrogen bonds, which can influence its interactions with biological macromolecules. Additionally, (3R)-3-hydroxy-2-benzofuran-1(3H)-one may participate in various chemical reactions, such as oxidation and conjugation, making it of interest in both synthetic and medicinal chemistry. Overall, its unique structural features and biological relevance make it a compound of interest in research and potential therapeutic applications.
Formula:C8H6O3
InChI:InChI=1/C8H6O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4,7,9H/t7-/m1/s1
InChI key:JKNKNWJNCOJPLI-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)[C@H](O)OC2=O
Synonyms:
  • 3-Hydroxyisobenzofuran-1(3H)-one
Found 8 products.