
CAS 16867-57-5
:DIETHYL 2-([(5-CHLORO-2-PYRIDINYL)AMINO]METHYLENE)MALONATE
Description:
Diethyl 2-([(5-chloro-2-pyridinyl)amino]methylene)malonate, with CAS number 16867-57-5, is a chemical compound characterized by its unique structure that includes a malonate moiety and a pyridine ring substituted with a chlorine atom. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its polar and non-polar characteristics. The presence of the amino group linked to the pyridine enhances its reactivity, making it a potential candidate for various chemical reactions, including those in medicinal chemistry and agrochemicals. Its malonate structure suggests potential applications in synthesis, particularly in the formation of more complex molecules. Additionally, the chlorine substituent may influence its biological activity and interaction with other chemical entities. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, diethyl 2-([(5-chloro-2-pyridinyl)amino]methylene)malonate is a compound of interest in both research and industrial applications.
Formula:C13H15ClN2O4
InChI:InChI=1S/C13H15ClN2O4/c1-3-19-12(17)10(13(18)20-4-2)8-16-11-6-5-9(14)7-15-11/h5-8H,3-4H2,1-2H3,(H,15,16)
InChI key:RTRWZEILYDFBNP-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=CNC1=NC=C(C=C1)Cl)C(=O)OCC
Synonyms:- Diethyl 2-(((5-chloropyridin-2-yl)aMino)Methylene)Malonate
- DIETHYL 2-([(5-CHLORO-2-PYRIDINYL)AMINO]METHYLENE)MALONATE
- Propanedioic acid, 2-[[(5-chloro-2-pyridinyl)amino]methylene]-, 1,3-diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diethyl 2-(((5-chloropyridin-2-yl)amino)methylene)malonate
CAS:Formula:C13H15ClN2O4Molecular weight:298.7222
