CAS 16907-79-2
:Quinaldicacidsodiumsalt
Description:
Quinaldic acid sodium salt, identified by the CAS number 16907-79-2, is a chemical compound that serves as a sodium salt derivative of quinaldic acid. It typically appears as a white to off-white solid and is soluble in water, which enhances its utility in various applications. This compound is known for its role in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Quinaldic acid itself is derived from quinoline and is characterized by its aromatic structure, which contributes to its reactivity and interaction with other chemical species. The sodium salt form often exhibits improved stability and solubility compared to its acid counterpart. In terms of safety, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any potential hazards associated with its use. Overall, quinaldic acid sodium salt is a valuable compound in both research and industrial contexts due to its versatile chemical properties.
Formula:C10H6NNaO2
InChI:InChI=1/C10H7NO2.Na/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);/q;+1/p-1
SMILES:c1ccc2c(c1)ccc(C(=O)O)n2.[Na]
Synonyms:- Quinaldic acid sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Quinaldic Acid Sodium Salt
CAS:Quinaldic Acid Sodium SaltFormula:C10H6NNaO2Purity:>98.0%Molecular weight:195.152-Quinolinecarboxylic acid, sodium salt (1:1)
CAS:Formula:C10H6NNaO2Purity:98.0%Color and Shape:SolidMolecular weight:195.1499Quinaldic Acid Sodium Salt
CAS:Formula:C10H6NNaO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:195.15Quinaldic Acid Sodium Salt
CAS:Controlled ProductApplications Quinaldic Acid Sodium Salt (cas# 16907-79-2) is a useful research chemical.
Formula:C10H6NNaO2Color and Shape:NeatMolecular weight:195.15





