CymitQuimica logo

CAS 169205-78-1

:

N~4~-(3-bromophenyl)quinazoline-4,6-diamine

Description:
N~4~-(3-bromophenyl)quinazoline-4,6-diamine is a chemical compound characterized by its quinazoline core, which is a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features a bromophenyl substituent at the N~4~ position and two amino groups at the 4 and 6 positions of the quinazoline ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity. The amino groups contribute to its potential as a ligand in various chemical reactions and biological interactions. This compound may exhibit properties such as solubility in organic solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the presence of the bromine atom may enhance its pharmacological properties or selectivity in biological systems. Overall, N~4~-(3-bromophenyl)quinazoline-4,6-diamine is of interest for its potential applications in drug discovery and development.
Formula:C14H11BrN4
InChI:InChI=1/C14H11BrN4/c15-9-2-1-3-11(6-9)19-14-12-7-10(16)4-5-13(12)17-8-18-14/h1-8H,16H2,(H,17,18,19)
InChI key:IZQHULBHKPGOAP-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)Nc1c2cc(ccc2ncn1)N)Br
Synonyms:
  • 4,6-quinazolinediamine, N~4~-(3-bromophenyl)-
  • N4-(3-bromo-phenyl)-quinazoline-4,6-diamine
Found 4 products.