CymitQuimica logo

CAS 169206-55-7

:

tert-butyl 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate

Description:
Tert-butyl 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of the 2-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The diazaspiro framework suggests that the compound may exhibit interesting conformational properties and could be relevant in medicinal chemistry, particularly in the design of bioactive molecules. Additionally, the carboxylate moiety may enhance its reactivity and interaction with biological targets. Overall, the structural complexity and functional groups present in tert-butyl 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C12H20N2O4
InChI:InChI=1/C12H20N2O4/c1-11(2,3)18-10(16)14-6-4-12(5-7-14)8-13-9(15)17-12/h4-8H2,1-3H3,(H,13,15)
InChI key:FUTMXISUVQILLR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CN=C(O)O2
Synonyms:
  • 1-Oxa-3,8-Diazaspiro[4.5]Decane-8-Carboxylic Acid, 2-Oxo-, 1,1-Dimethylethyl Ester
  • tert-Butyl 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate
Found 4 products.