CymitQuimica logo

CAS 1698028-23-7

:

methyl 2-amino-4-bromo-6-fluorobenzoate

Description:
Methyl 2-amino-4-bromo-6-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with various substituents. The presence of an amino group (-NH2), a bromo group (-Br), and a fluoro group (-F) on the benzene ring contributes to its reactivity and potential applications in pharmaceuticals and agrochemicals. The methyl ester functional group (-COOCH3) enhances its solubility in organic solvents, making it suitable for various synthetic processes. This compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. Additionally, the halogen substituents (bromo and fluoro) can influence the compound's electronic properties, stability, and lipophilicity. Overall, methyl 2-amino-4-bromo-6-fluorobenzoate is a versatile compound with potential utility in chemical synthesis and medicinal chemistry, although specific applications would depend on further research and characterization.
Formula:C8H7BrFNO2
InChI:InChI=1S/C8H7BrFNO2/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3H,11H2,1H3
InChI key:RBMIFLUDJHVUDS-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=C(C=C1F)Br)N
Synonyms:
  • Benzoic acid, 2-amino-4-bromo-6-fluoro-, methyl ester
  • methyl 2-amino-4-bromo-6-fluorobenzoate
  • 2-amino-4-bromo-6-fluorobenzoate
Found 4 products.