CymitQuimica logo

CAS 1703-07-7

:

6-chloro-5-methyl-2H-pyridazin-3-one

Description:
6-Chloro-5-methyl-2H-pyridazin-3-one is a heterocyclic organic compound characterized by its pyridazine ring structure, which consists of two adjacent nitrogen atoms in a six-membered ring. This compound features a chlorine atom at the 6-position and a methyl group at the 5-position, contributing to its unique chemical properties. It is typically a crystalline solid and is soluble in polar organic solvents. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which can be attributed to its structural features, and it is often studied for its potential therapeutic effects. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C5H5ClN2O
InChI:InChI=1/C5H5ClN2O/c1-3-2-4(9)7-8-5(3)6/h2H,1H3,(H,7,9)
InChI key:UGDOVAWXAHZLEV-UHFFFAOYSA-N
SMILES:Cc1cc(nnc1Cl)O
Synonyms:
  • 3(2H)-Pyridazinone, 6-chloro-5-methyl-
  • 6-Chloro-5-methyl-3(2H)-pyridazinone
  • 6-chloro-5-methylpyridazin-3(2H)-one
Found 4 products.