CymitQuimica logo

CAS 1704063-66-0

:

B-[2-[3-Oxo-3-(4-oxo-1-piperidinyl)propyl]phenyl]boronic acid

Description:
B-[2-[3-Oxo-3-(4-oxo-1-piperidinyl)propyl]phenyl]boronic acid, identified by its CAS number 1704063-66-0, is a boronic acid derivative characterized by its unique structural features, including a boron atom bonded to a phenyl group and a piperidine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the ketone functional groups contributes to its reactivity and potential biological activity. Additionally, the piperidine ring may influence its pharmacokinetic properties, such as solubility and permeability. Overall, this compound's structural complexity suggests potential utility in drug development, particularly in targeting specific biological pathways or as a building block in organic synthesis. Its characteristics, including solubility, stability, and reactivity, would be influenced by the specific functional groups and their arrangement within the molecule.
Formula:C14H18BNO4
InChI:InChI=1S/C14H18BNO4/c17-12-7-9-16(10-8-12)14(18)6-5-11-3-1-2-4-13(11)15(19)20/h1-4,19-20H,5-10H2
InChI key:InChIKey=QKXSIZTYFGKKOD-UHFFFAOYSA-N
SMILES:C(CC(=O)N1CCC(=O)CC1)C2=C(B(O)O)C=CC=C2
Synonyms:
  • Boronic acid, B-[2-[3-oxo-3-(4-oxo-1-piperidinyl)propyl]phenyl]-
  • B-[2-[3-Oxo-3-(4-oxo-1-piperidinyl)propyl]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.