
CAS 1704730-70-0
:Benzonitrile, 4,4'-[[5-bromo-2-[(4-cyanophenyl)amino]-4,6-pyrimidinediyl]bis(oxy)]bis[3,5-dimethyl-
Description:
Benzonitrile, 4,4'-[[5-bromo-2-[(4-cyanophenyl)amino]-4,6-pyrimidinediyl]bis(oxy)]bis[3,5-dimethyl- is a complex organic compound characterized by its structural features, which include a benzonitrile moiety and a pyrimidine derivative. The presence of bromine and multiple functional groups, such as amine and ether linkages, suggests potential reactivity and applications in medicinal chemistry or as a building block in organic synthesis. The compound's molecular structure indicates it may exhibit specific biological activities, possibly related to its interactions with biological targets due to the presence of the cyanophenyl and pyrimidine components. Additionally, the dimethyl groups may influence its solubility and steric properties. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments. Safety data and handling precautions should be considered due to the presence of bromine and potential toxicity associated with nitriles and amines.
Formula:C29H21BrN6O2
InChI:InChI=1S/C29H21BrN6O2/c1-16-9-21(14-32)10-17(2)25(16)37-27-24(30)28(38-26-18(3)11-22(15-33)12-19(26)4)36-29(35-27)34-23-7-5-20(13-31)6-8-23/h5-12H,1-4H3,(H,34,35,36)
InChI key:WXJWJJMTWABFNY-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1OC2=C(C(=NC(=N2)NC3=CC=C(C=C3)C#N)OC4=C(C=C(C=C4C)C#N)C)Br)C)C#N
Synonyms:- 4,4''-((5-Bromo-2-((4-cyanophenyl)amino)pyrimidine-4,6-diyl)bis(oxy))bis(3,5-dimethylbenzonitrile)
- Etravirine Impurity 6
- 4,4'-[[5-Bromo-2-[(4-cyanophenyl)amino]-4,6-pyrimidinediyl]bis(oxy)]bis[3,5-dimethylbenzonitrile
- Etravirine Impurity 6 Q: What is the CAS Number of
- Benzonitrile, 4,4'-[[5-bromo-2-[(4-cyanophenyl)amino]-4,6-pyrimidinediyl]bis(oxy)]bis[3,5-dimethyl-
- Etravirine Impurity 6Q: What is
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4,4'-[[5-Bromo-2-[(4-cyanophenyl)amino]-4,6-pyrimidinediyl]bis(oxy)]bis[3,5-dimethylbenzonitrile]
CAS:Controlled ProductFormula:C29H21BrN6O2Color and Shape:NeatMolecular weight:565.42


