CymitQuimica logo

CAS 170737-53-8

:

1-N-Cbz-4-Methoxycarbonylmethyl-piperidine

Description:
1-N-Cbz-4-Methoxycarbonylmethyl-piperidine, with the CAS number 170737-53-8, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The "Cbz" refers to a benzyloxycarbonyl protecting group, commonly used in organic synthesis to protect amines. The "methoxycarbonylmethyl" substituent indicates the presence of a methoxycarbonyl group, which is an ester functional group that can influence the compound's reactivity and solubility. This compound is typically utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules, due to its functional groups that allow for further chemical modifications. Its structure suggests potential applications in medicinal chemistry, where piperidine derivatives are often explored for their biological activity. The presence of both the Cbz and methoxycarbonyl groups provides versatility in chemical reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and other bioactive compounds.
Formula:C16H21NO4
InChI:InChI=1S/C16H21NO4/c1-20-15(18)11-13-7-9-17(10-8-13)16(19)21-12-14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3
InChI key:BQZCKUIDFAVCTI-UHFFFAOYSA-N
SMILES:COC(=O)CC1CCN(CC1)C(=O)OCC2=CC=CC=C2
Found 4 products.