CymitQuimica logo

CAS 170838-26-3

:

1-Boc-4-(2-Carboxyphenyl) Piperidine

Description:
1-Boc-4-(2-Carboxyphenyl) Piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group for amines, indicating that the nitrogen atom in the piperidine is protected to prevent unwanted reactions during synthetic processes. The presence of the 2-carboxyphenyl group suggests that the compound has a phenyl ring substituted with a carboxylic acid functional group, which can impart acidic properties and enhance solubility in polar solvents. This compound is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. Its structure allows for various chemical modifications, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the presence of both the carboxylic acid and the piperidine moiety may contribute to its ability to interact with biological targets, making it of interest in drug discovery and development.
Formula:C17H23NO4
InChI:InChI=1S/C17H23NO4/c1-17(2,3)22-16(21)18-10-8-12(9-11-18)13-6-4-5-7-14(13)15(19)20/h4-7,12H,8-11H2,1-3H3,(H,19,20)
InChI key:NPKPUCNATSURJQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC=C2C(=O)O
Found 5 products.