CAS 170981-41-6
:2,3-Difluoro-4-methoxyphenylboronic acid
Description:
2,3-Difluoro-4-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two fluorine atoms and a methoxy group as substituents. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The fluorine atoms enhance the compound's electronic properties, potentially influencing its reactivity and biological activity. The methoxy group can also affect solubility and stability. Additionally, this compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, which can be explored in drug development and material science. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for proper storage conditions to maintain its integrity.
Formula:C7H7BF2O3
InChI:InChI=1/C7H7BF2O3/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3,11-12H,1H3
SMILES:COc1ccc(c(c1F)F)B(O)O
Synonyms:- 2,3-Difluoroanisylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Difluoro-4-methoxyphenylboronic acid
CAS:Formula:C7H7BF2O3Purity:97%Color and Shape:SolidMolecular weight:187.93652,3-Difluoro-4-methoxybenzeneboronic acid
CAS:2,3-Difluoro-4-methoxybenzeneboronic acidFormula:C7H7BF2O3Purity:97%Color and Shape:Off-white SolidMolecular weight:187.936482,3-Difluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H7BF2O3Purity:97.0 to 110.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:187.94(2,3-Difluoro-4-methoxyphenyl)boronic acid
CAS:Formula:C7H7BF2O3Purity:95%Color and Shape:SolidMolecular weight:187.94(2,3-Difluoro-4-methoxyphenyl)boronic acid
CAS:(2,3-Difluoro-4-methoxyphenyl)boronic acidFormula:C7H7BF2O3Purity:97%Molecular weight:187.94




