CymitQuimica logo

CAS 17100-58-2

:

4-Bromo-2-methylbenzyl alcohol

Description:
4-Bromo-2-methylbenzyl alcohol, with the CAS number 17100-58-2, is an organic compound characterized by the presence of a bromine atom and a hydroxyl group (-OH) attached to a benzyl structure. This compound features a bromine substituent at the para position and a methyl group at the ortho position relative to the hydroxyl group on the benzene ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. The hydroxyl group imparts alcohol characteristics, allowing for hydrogen bonding, which can influence its solubility in polar solvents. Additionally, 4-Bromo-2-methylbenzyl alcohol may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H9BrO
InChI:InChI=1S/C8H9BrO/c1-6-4-8(9)3-2-7(6)5-10/h2-4,10H,5H2,1H3
InChI key:IFKWLKCPUIQXPU-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)Br)CO
Found 5 products.