CAS 1713-33-3
:1-methyl-7-oxabicyclo[4.1.0]heptane
Description:
1-Methyl-7-oxabicyclo[4.1.0]heptane, with the CAS number 1713-33-3, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a seven-membered ring with an oxygen atom incorporated into the framework. This compound features a methyl group attached to one of the carbon atoms in the bicyclic system, influencing its chemical properties and reactivity. The presence of the oxygen atom contributes to its potential as a functional group, which may participate in various chemical reactions, including nucleophilic attacks or hydrogen bonding. The bicyclic nature of the compound can impart rigidity to its structure, affecting its physical properties such as boiling point, melting point, and solubility. Additionally, the compound may exhibit interesting stereochemistry due to the arrangement of its substituents, which can influence its interactions in biological systems or its utility in synthetic chemistry. Overall, 1-methyl-7-oxabicyclo[4.1.0]heptane is a compound of interest in organic synthesis and may have applications in medicinal chemistry or materials science.
Formula:C7H12O
InChI:InChI=1/C7H12O/c1-7-5-3-2-4-6(7)8-7/h6H,2-5H2,1H3/t6-,7+/m1/s1
Synonyms:- 1,2-Epoxy-1-methylcyclohexane
- 1-Methyl-1,2-epoxycyclohexane
- (1S,6R)-1-methyl-7-oxabicyclo[4.1.0]heptane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Methyl-1,2-epoxycyclohexane
CAS:Formula:C7H12OPurity:>95.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:112.171,2-Epoxy-1-methylcyclohexane
CAS:1,2-Epoxy-1-methylcyclohexaneFormula:C7H12OPurity:97%Molecular weight:112.169581-methyl-7-oxabicyclo[4.1.0]heptane
CAS:Formula:C7H12OPurity:96%Color and Shape:LiquidMolecular weight:112.16961,2-Epoxy-1-methylcyclohexane
CAS:1,2-Epoxy-1-methylcyclohexaneFormula:C7H12OPurity:97%Molecular weight:112.171,2-Epoxy-1-methyl-cyclohexane
CAS:1,2-Epoxy-1-methylcyclohexane is a nucleophile that is useful for the synthesis of epoxides. It is a bifunctional compound that can be used as an asymmetric synthesis catalyst. 1,2-Epoxy-1-methylcyclohexane has been shown to react with urea derivatives to form epoxides through reductive elimination. This reaction also produces cyclopentene oxide as a byproduct. The selectivity of this reaction depends on the temperature and acidic conditions used in the reaction. 1,2-Epoxy-1-methylcyclohexane has significant homology with other epoxides and epoxide derivatives. Epoxides are organic compounds with two hydrocarbons covalently bonded by one oxygen atom. Epoxides are typically produced from alkenes and are classified into three groups: simple (single bond), ethylenic (double bond), and cyclic (three or more bonds).Formula:C7H12OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:112.17 g/mol





