CymitQuimica logo

CAS 17148-49-1

:

5-Fluoro-2-methoxypyrimidine

Description:
5-Fluoro-2-methoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a fluorine atom at the 5-position and a methoxy group at the 2-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to act as a building block for various bioactive molecules. The presence of the fluorine atom can enhance the compound's metabolic stability and lipophilicity, while the methoxy group may influence its solubility and reactivity. 5-Fluoro-2-methoxypyrimidine is generally soluble in organic solvents and may exhibit moderate stability under standard conditions, although it should be handled with care due to potential reactivity. Its chemical properties make it a valuable intermediate in the synthesis of nucleoside analogs and other therapeutic agents.
Formula:C5H5FN2O
InChI:InChI=1S/C5H5FN2O/c1-9-5-7-2-4(6)3-8-5/h2-3H,1H3
InChI key:InChIKey=PDKCCWWWQBMOCA-UHFFFAOYSA-N
SMILES:O(C)C=1N=CC(F)=CN1
Synonyms:
  • 2-Methoxy-5-fluoropyrimidine
  • Pyrimidine, 5-fluoro-2-methoxy-
  • 5-Fluoro-2-methoxypyrimidine
Found 4 products.