CAS 17220-38-1
:3,4-Diaminofurazan
Description:
3,4-Diaminofurazan is an organic compound characterized by its unique furazan ring structure, which features two amino groups at the 3 and 4 positions. This compound is known for its energetic properties, making it of interest in the field of explosives and propellants. It typically appears as a crystalline solid and is relatively stable under standard conditions, although it can be sensitive to heat and shock. The presence of the amino groups contributes to its reactivity, allowing for various chemical modifications and applications in synthesis. 3,4-Diaminofurazan is also notable for its potential use in the development of high-performance materials due to its energetic characteristics. Its molecular structure allows for hydrogen bonding, which can influence its solubility and interaction with other substances. Safety precautions are essential when handling this compound, as it may pose risks associated with its energetic nature. Overall, 3,4-Diaminofurazan is a compound of significant interest in both academic research and practical applications in materials science.
Formula:C4H6N2O
InChI:InChI=1/C4H6N2O/c5-3-1-7-2-4(3)6/h1-2H,5-6H2
SMILES:c1c(c(co1)N)N
Synonyms:- 1,2,5-Oxadiazole-3,4-diamine
- Furazandiamine
- Furan-3,4-Diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,5-Oxadiazole-3,4-diamine
CAS:Formula:C2H4N4OPurity:97%Color and Shape:SolidMolecular weight:100.0794Ref: IN-DA0032K8
1kgTo inquire1g20.00€5g25.00€10g40.00€25g62.00€50g97.00€100g134.00€250g234.00€500g590.00€5kg2,519.00€10kg4,457.00€1,2,5-Oxadiazole-3,4-diamine
CAS:1,2,5-Oxadiazole-3,4-diamineFormula:C2H4N4OPurity:>98%Molecular weight:100.0813,4-Diaminofurazan
CAS:Formula:C2H4N4OPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:100.081,2,5-Oxadiazole-3,4-diamine
CAS:1,2,5-Oxadiazole-3,4-diamineFormula:C2H4N4OPurity:97%Molecular weight:100.083,4-Diaminofurazan
CAS:3,4-Diaminofurazan is a chemical compound that is stable in an oral environment. It has an optimal reactivity with a pyrazole ring and methoxy groups. 3,4-Diaminofurazan is active against Staphylococcus aureus strains that are resistant to other antibiotics. The molecule has been shown to inhibit bacterial growth by inhibiting the synthesis of DNA and RNA. The kinetic of 3,4-diaminofurazan was studied using nitro as the substrate, and it had an activation energy of 11.8 kcal/mol at 298 K. The chemical structure of 3,4-diaminofurazan has been determined by x-ray crystallography and nuclear magnetic resonance spectroscopy (NMR). It can be synthesized using nitric acid or hydrochloric acid as solvents: 1) Nitric Acid Synthesis: 2) HydrochlorFormula:C2H4N4OPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:100.08 g/mol3,4-Diaminofurazan
CAS:Formula:C2H4N4OPurity:95%Color and Shape:Solid, White crystalline powderMolecular weight:100.081Ref: 10-F013501
Discontinued product





