CAS 172333-26-5

2-Chloro-ethanaMine-d4 Hydrochloride

Description:

2-Chloro-ethanamine-d4 hydrochloride, with the CAS number 172333-26-5, is a deuterated derivative of 2-chloroethanamine, which is an amine compound featuring a chlorine atom attached to a two-carbon ethyl chain. The "d4" designation indicates that the compound contains four deuterium atoms, which are isotopes of hydrogen, replacing regular hydrogen atoms in the molecular structure. This substitution is often utilized in research and analytical applications, particularly in NMR spectroscopy, to enhance the clarity of spectral data. The hydrochloride form indicates that the compound is in a salt form, which typically improves its solubility in water and stability. As an amine, it can participate in various chemical reactions, including nucleophilic substitutions and the formation of amides. The presence of the chlorine atom also makes it a potential precursor for further chemical synthesis. Overall, 2-Chloro-ethanamine-d4 hydrochloride is valuable in both synthetic organic chemistry and as a labeled compound in biochemical research.

Formula: C₂H₇Cl₂N

InChI: InChI=1S/C2H6ClN.ClH/c3-1-2-4;/h1-2,4H2;1H/i1D2,2D2;

InChI key: ONRREFWJTRBDRA-PBCJVBLFSA-N

SMILES: [2H]C([2H])(C([2H])([2H])Cl)N.Cl

Synonyms:

• 2-Chloro-ethanaMine-d4 Hydrochloride
• 2-chloro-d4-ethanamine hydrochloride
• 2-Chloroethyl-d4-aMine HCl

2-Chloroethyl-d4-amine HCl

CAS: 172333-26-5, 870-24-6

Formula: ClCD₂CD₂NH₂HCl

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 119.02066

Ref: 3U-D6877

2-Chloro-ethanamine-d4 Hydrochloride

Controlled Product

CAS: 172333-26-5

Applications 2-Chloro-ethanamine-d4 Hydrochloride (cas# 172333-26-5) is a compound useful in organic synthesis.

Formula: C₂D₄H₃Cl₂N

Color and Shape: Neat

Molecular weight: 120.01

Ref: TR-C365737