CymitQuimica logo

CAS 172702-58-8

:

Boc-Asp(OBzl)-chloromethylketone

Description:
Boc-Asp(OBzl)-chloromethylketone, with the CAS number 172702-58-8, is a chemical compound that features a protected aspartic acid derivative. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, while the "OBzl" (benzyl ether) group protects the hydroxyl group of aspartic acid. The presence of a chloromethylketone moiety indicates that this compound possesses a reactive chloromethyl group, which can participate in nucleophilic substitution reactions, making it useful in peptide synthesis and other organic transformations. This compound is typically utilized in the field of medicinal chemistry and peptide synthesis due to its ability to facilitate the formation of peptide bonds and modify amino acids. Its reactivity and protective groups allow for selective reactions, making it a valuable intermediate in the synthesis of more complex molecules. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with reactive functional groups.
Formula:C17H22ClNO5
InChI:InChI=1S/C17H22ClNO5/c1-17(2,3)24-16(22)19-13(14(20)10-18)9-15(21)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,19,22)/t13-/m0/s1
InChI key:BKSBJYSNALKVEA-ZDUSSCGKSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC(=O)OCC1=CC=CC=C1)C(=O)CCl
Found 3 products.