CymitQuimica logo

CAS 172739-03-6

:

Pyrrolo[3,4-c]pyrrole, octahydro-2-methyl-, cis- (9CI)

Description:
Pyrrolo[3,4-c]pyrrole, octahydro-2-methyl-, cis- (CAS 172739-03-6) is a bicyclic organic compound characterized by its unique fused ring structure, which consists of a pyrrole ring fused to a saturated cyclohexane-like system. This compound is typically colorless to pale yellow and exhibits a relatively low volatility, making it stable under standard conditions. It is known for its potential applications in various fields, including organic electronics, dyes, and pigments, due to its ability to absorb light and its stability against photodegradation. The presence of the methyl group contributes to its chemical reactivity and solubility properties. Additionally, the cis configuration of the compound influences its stereochemistry, which can affect its interactions with other molecules. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, this compound represents a significant interest in materials science and organic synthesis due to its structural properties and potential applications.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-9-4-6-2-8-3-7(6)5-9/h6-8H,2-5H2,1H3/t6-,7+
InChI key:YQURLNGUWNDBIR-KNVOCYPGSA-N
SMILES:CN1C[C@H]2CNC[C@H]2C1
Synonyms:
  • octahydro-2-Methylpyrrolo[3,4-c]pyrrole
  • (3aR,6aS)-2-Methyloctahydropyrrolo[3,4-c]pyrrole
  • Pyrrolo[3,4-c]pyrrole, octahydro-2-Methyl-, cis-
  • Pyrrolo[3,4-c]pyrrole, octahydro-2-methyl-, cis- (9CI)
  • Pyrrolo[3,4-c]pyrrole, octahydro-2-methyl-, (3aR,6aS)-rel-
  • cis-2-Methyloctahydropyrrolo[3,4-c]pyrrole
Found 5 products.