CAS 1729-67-5
:Propanoic acid, 2,3-dibromo-, methyl ester
Description:
Propanoic acid, 2,3-dibromo-, methyl ester, also known by its CAS number 1729-67-5, is an organic compound characterized by the presence of a propanoic acid backbone with two bromine substituents at the 2 and 3 positions and a methyl ester functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the ester group. The bromine atoms contribute to its reactivity, making it a potential intermediate in organic synthesis and a subject of interest in various chemical reactions, including nucleophilic substitutions. The presence of the ester functional group suggests that it may undergo hydrolysis in the presence of water or bases, leading to the formation of the corresponding acid and alcohol. Additionally, the compound's structure may impart specific biological activities, making it relevant in fields such as medicinal chemistry and agrochemicals. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health and environmental risks.
Formula:C4H6Br2O2
InChI:InChI=1S/C4H6Br2O2/c1-8-4(7)3(6)2-5/h3H,2H2,1H3
InChI key:InChIKey=ROXQOUUAPQUMLN-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(CBr)Br
Synonyms:- (±)-2,3-Dibromopropionic acid methyl ester
- 2,3-Dibromopropanoic acid methyl ester
- Ai3-50603
- Caswell No. 561
- EPA Pesticide Chemical Code 077706
- Methyl 2,3-dibromopropanoate
- Methyl α,β-dibromopropionate
- Nsc 9372
- Propanoic acid, 2,3-dibromo-, methyl ester
- Propionic acid, 2,3-dibromo-, methyl ester
- Propionic acid, 2,3-dibromo-, methyl ester (8CI)
- Methyl 2,3-dibromopropionate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2,3-Dibromopropionate
CAS:Formula:C4H6Br2O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:245.90Methyl 2,3-dibromopropanoate
CAS:Methyl 2,3-dibromopropanoateFormula:C4H6Br2O2Purity:97%Molecular weight:245.9Methyl 2,3-dibromopropanoate
CAS:Methyl 2,3-dibromopropanoateFormula:C4H6Br2O2Purity:≥95%Color and Shape:Colourless LiquidMolecular weight:245.89724methyl 2,3-dibromopropanoate
CAS:Formula:C4H6Br2O2Purity:97%Color and Shape:LiquidMolecular weight:245.8972METHYL 2,3-DIBROMOPROPANOATE
CAS:Formula:C4H6Br2O2Purity:95%Color and Shape:Liquid, ClearMolecular weight:245.898





