CAS 173043-38-4

2-Naphthalenecarboxylic acid, 3-amino-1,4-dihydro-1,4-dioxo-

Description:

2-Naphthalenecarboxylic acid, 3-amino-1,4-dihydro-1,4-dioxo- is a chemical compound characterized by its naphthalene backbone, which consists of two fused aromatic rings. The presence of a carboxylic acid group (-COOH) indicates its acidic nature, while the amino group (-NH2) contributes to its potential as a building block in organic synthesis and pharmaceuticals. The compound features a 1,4-dihydro-1,4-dioxo structure, suggesting it may exhibit keto-enol tautomerism, which can influence its reactivity and stability. This compound is likely to be soluble in polar solvents due to the presence of both the carboxylic acid and amino groups, which can engage in hydrogen bonding. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and application in various chemical contexts.

Formula: C₁₁H₇NO₄

InChI: InChI=1S/C11H7NO4/c12-8-7(11(15)16)9(13)5-3-1-2-4-6(5)10(8)14/h1-4,12-13H,(H,15,16)

InChI key: LUUNBSJOKUEDSL-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C(=C(C(=N)C2=O)C(=O)O)O

2-Amino-3-carboxy-1,4-naphthoquinone

CAS: 173043-38-4

2-Amino-3-carboxy-1,4-naphthoquinone

Formula: C₁₁H₇NO₄

Purity: ≥98%

Molecular weight: 217.18

Ref: 54-OR1131966

2-Amino-3-carboxy-1,4-naphthoquinone

CAS: 173043-38-4

Formula: C₁₁H₇NO₄

Purity: 95%~99%

Molecular weight: 217.18

Ref: BP-BP5667

2-Amino-3-carboxy-1,4-naphthoquinone

CAS: 173043-38-4

2-Amino-3-carboxy-1,4-naphthoquinone is an electron transfer mediator that can alter glucose metabolism in homofermentative lactic acid bacteria. It also serves as a novel growth stimulator for bifidobacteria, influencing their end-product profile through the mediated oxidation of NAD(P)H.

Formula: C₁₁H₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 217.1776

Ref: TM-TN1208

2-Amino-3-carboxy-1,4-naphthoquinone

CAS: 173043-38-4

Purity: 98%

Ref: IN-DA01DDFY

2-Amino-3-carboxy-1,4-naphthoquinone

CAS: 173043-38-4

2-Amino-3-carboxy-1,4-naphthoquinone is a heterocyclic organic compound, which is a derivative of naphthoquinone, sourced from various chemical synthesis pathways. These pathways often involve the introduction of amino and carboxy functional groups onto the naphthoquinone core, facilitating its creation in controlled laboratory settings. This compound acts primarily due to its electron-accepting quinone structure, enabling redox cycling and interaction with biological macromolecules. These interactions can disrupt cellular redox homeostasis or inhibit protein functions, positioning the compound as a candidate for various biochemical applications.

Formula: C₁₁H₇NO₄

Purity: Min. 95%

Molecular weight: 217.18 g/mol

Ref: 3D-YGA04338