
CAS 17312-76-4
:6,6-Dimethylundecane
Description:
6,6-Dimethylundecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C13H28, indicating it consists of 13 carbon atoms and 28 hydrogen atoms. This compound features two methyl groups attached to the sixth carbon of the undecane chain, which contributes to its branched structure. 6,6-Dimethylundecane is typically a colorless liquid at room temperature and exhibits low volatility and relatively low solubility in water, characteristic of many alkanes due to their nonpolar nature. It has a relatively high boiling point compared to straight-chain alkanes of similar molecular weight, owing to its branched structure, which reduces surface area and, consequently, van der Waals forces. This compound is primarily of interest in organic chemistry and industrial applications, including as a potential fuel additive or in the synthesis of other chemical compounds. Safety data indicates that, like many hydrocarbons, it should be handled with care due to flammability and potential health hazards upon inhalation or skin contact.
Formula:C13H28
InChI:InChI=1S/C13H28/c1-5-7-9-11-13(3,4)12-10-8-6-2/h5-12H2,1-4H3
InChI key:InChIKey=ZFOODCBUKSMZBZ-UHFFFAOYSA-N
SMILES:C(C(CCCCC)(C)C)CCCC
Synonyms:- 6,6-Dimethylundecane
- Undecane, 6,6-dimethyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
