CAS 173194-95-1
:6-HYDROXY-2-NAPHTHALENEBORONIC ACID
Description:
6-Hydroxy-2-naphthaleneboronic acid, with the CAS number 173194-95-1, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a naphthalene ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The hydroxyl group on the naphthalene ring enhances its reactivity, making it useful in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. Additionally, the boronic acid functionality allows for the formation of reversible covalent bonds with diols, making it valuable in sensor applications and in the development of boron-containing materials. Its unique structural features contribute to its role in medicinal chemistry, particularly in the design of pharmaceuticals targeting specific biological pathways. Overall, 6-hydroxy-2-naphthaleneboronic acid is a versatile compound with significant applications in both research and industry.
Formula:C10H9BO3
InChI:InChI=1/C10H9BO3/c12-10-4-2-7-5-9(11(13)14)3-1-8(7)6-10/h1-6,12-14H
InChI key:InChIKey=SNJANQMHRGSHFN-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC2=C(C=C(O)C=C2)C=C1
Synonyms:- (6-Hydroxynaphthalen-2-Yl)Boronic Acid
- 6-Hydroxy-2-Naphtaleneboronic Acid
- 6-Hydroxy-2-Naphthyleneboronic Acid
- 6-Hydroxy-2-Napthalene Boronic Acid
- 6-Hydroxynaphthalene-2-Boronic Acid
- 6-Hydroxynaphthalene-2-boronic acid 98%
- Akos Brn-0430
- B-(6-Hydroxy-2-naphthalenyl)boronic acid
- Boronic acid, (6-hydroxy-2-naphthalenyl)-
- Boronic acid, B-(6-hydroxy-2-naphthalenyl)-
- 6-Hydroxy-2-naphthaleneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Hydroxy-2-naphthaleneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C10H9BO3Purity:97.0 to 111.0 %Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:187.99Boronic acid, B-(6-hydroxy-2-naphthalenyl)-
CAS:Formula:C10H9BO3Purity:98%Color and Shape:SolidMolecular weight:187.98776-Hydroxynaphthalene-2-boronic acid
CAS:6-Hydroxynaphthalene-2-boronic acidFormula:C10H9BO3Purity:98%Color and Shape:Off-white SolidMolecular weight:187.98766(6-Hydroxynaphthalen-2-yl)boronic acid
CAS:Formula:C10H9BO3Purity:98%Color and Shape:SolidMolecular weight:187.996-Hydroxynaphthalene-2-boronic acid
CAS:6-Hydroxynaphthalene-2-boronic acid is a versatile compound that can be used in various applications. It is commonly used as an electrode material due to its excellent conductivity and stability. This compound also exhibits nucleophilic properties, making it useful in organic synthesis reactions. Additionally, 6-Hydroxynaphthalene-2-boronic acid has shown potential in the treatment of botulinum toxin-induced muscle paralysis by acting as a monophosphate analog. It is derived from plasma and is classified as a research chemical. The bioavailability of this compound allows for efficient delivery and absorption in biological systems. Furthermore, 6-Hydroxynaphthalene-2-boronic acid forms stable complexes with silver chloride, making it suitable for analytical applications involving the detection of amines and chloride transport. Its unique properties make it a valuable tool for scientists and researchers working in various fields such as chemistry, biology, and pharmaceuticals.Formula:C10H9BO3Purity:Min. 95%Molecular weight:187.99 g/mol





