
CAS 1733-97-7
:Pyridinium, 1-(1-naphthalenylmethyl)-, chloride (1:1)
Description:
Pyridinium, 1-(1-naphthalenylmethyl)-, chloride (1:1), commonly referred to as a pyridinium salt, is an organic compound characterized by its pyridine ring structure substituted with a naphthylmethyl group. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the ionic chloride component. The presence of the naphthyl group contributes to its hydrophobic characteristics, which can influence its solubility and reactivity. Pyridinium salts are known for their applications in organic synthesis, acting as intermediates or catalysts in various chemical reactions. Additionally, they may exhibit biological activity, making them of interest in medicinal chemistry. The compound's stability is generally good under standard conditions, but it should be handled with care due to the potential for hygroscopic behavior and the presence of chloride ions, which can be corrosive. Overall, this compound exemplifies the diverse chemistry associated with pyridinium derivatives.
Formula:C16H14N·Cl
InChI:InChI=1S/C16H14N.ClH/c1-4-11-17(12-5-1)13-15-9-6-8-14-7-2-3-10-16(14)15;/h1-12H,13H2;1H/q+1;/p-1
InChI key:InChIKey=GWZGSBZBNYEUME-UHFFFAOYSA-M
SMILES:C(C=1C2=C(C=CC1)C=CC=C2)[N+]=3C=CC=CC3.[Cl-]
Synonyms:- 1-(1-Naphthylmethyl)pyridinium chloride
- Pyridinium, 1-(1-naphthalenylmethyl)-, chloride (1:1)
- Pyridinium, 1-(1-naphthylmethyl)-, chloride
- N-(α-Naphthylmethyl)pyridinium chloride
- Pyridinium, 1-(1-naphthalenylmethyl)-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
