
CAS 173429-83-9
:Ficusin A
Description:
Ficusin A, with the CAS number 173429-83-9, is a naturally occurring compound primarily derived from the Ficus species, particularly Ficus carica, commonly known as the common fig. This compound belongs to the class of flavonoids, which are known for their diverse biological activities. Ficusin A exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory and anticancer effects, making it of interest in pharmacological research. The compound's structure typically features multiple hydroxyl groups, contributing to its reactivity and interaction with various biological targets. Ficusin A is also noted for its role in traditional medicine, where it has been used for various therapeutic purposes. As with many natural products, the specific characteristics, including solubility and stability, can vary based on environmental conditions and the presence of other compounds. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in health and medicine.
Formula:C25H24O5
InChI:InChI=1S/C25H24O5/c1-13(2)17-9-4-14(3)10-18(17)22-20(27)11-21(28)23-24(29)19(12-30-25(22)23)15-5-7-16(26)8-6-15/h5-8,10-12,17-18,26-28H,1,4,9H2,2-3H3/t17-,18+/m0/s1
InChI key:LRYZMDSDXSWBMU-ZWKOTPCHSA-N
SMILES:CC1=C[C@H]([C@@H](CC1)C(=C)C)C2=C(C=C(C3=C2OC=C(C3=O)C4=CC=C(C=C4)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ficusin A
CAS:"Ficusin improves insulin sensitivity and treats obesity-related type 2 diabetes by enhancing PPARγ and GLUT4 in adipose tissue."Formula:C25H24O5Purity:98%Color and Shape:SolidMolecular weight:404.46Ficusin A
CAS:Controlled ProductFicusin A is a secondary metabolite of the ficus tree. It has been found to have cytotoxic and anti-inflammatory properties. Ficusin A is a potent inhibitor of protein tyrosine phosphatase 1B (PTP1B), which is involved in the regulation of insulin signaling. In addition, it has been shown to inhibit the activity of human erythrocyte glutathione reductase and to exhibit antioxidant activity.Formula:C25H24O5Purity:Min. 95%Molecular weight:404.5 g/mol





