CymitQuimica logo

CAS 17351-07-4

:

(1S,2R)-Cyclohexane-1,2-dicarboxylic acid diethyl ester

Description:
(1S,2R)-Cyclohexane-1,2-dicarboxylic acid diethyl ester, with CAS number 17351-07-4, is an organic compound characterized by its cyclohexane ring structure substituted with two carboxylic acid groups, each esterified with ethyl groups. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic cyclohexane framework. The presence of the diethyl ester functional groups contributes to its reactivity, making it useful in various chemical syntheses and applications, including as a building block in organic chemistry. Its stereochemistry, indicated by the (1S,2R) configuration, suggests specific spatial arrangements that can influence its physical and chemical properties, including boiling point and reactivity. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Proper handling and storage are essential due to potential hazards associated with organic esters.
Formula:C12H20O4
InChI:InChI=1S/C12H20O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h9-10H,3-8H2,1-2H3/t9-,10+
InChI key:ZTUZDYWYNQDJKR-AOOOYVTPSA-N
SMILES:CCOC(=O)[C@@H]1CCCC[C@@H]1C(=O)OCC
Synonyms:
  • cis-1,2-Cyclohexanedicarboxylic Acid Diethyl Ester
  • Diethyl cis-1,2-Cyclohexanedicarboxylate
Found 4 products.