CAS 173550-97-5
:Terephthalic acid mono(2-bromoethyl) ester
Description:
Terephthalic acid mono(2-bromoethyl) ester, with the CAS number 173550-97-5, is an organic compound derived from terephthalic acid. It features an ester functional group, which is formed by the reaction of terephthalic acid with 2-bromoethanol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for esters. The presence of the bromoethyl group introduces reactivity, making it useful in various chemical synthesis applications, particularly in the production of polymers and other derivatives. Additionally, the compound may exhibit properties such as thermal stability and potential reactivity in nucleophilic substitution reactions due to the bromine atom. Safety considerations should be taken into account, as brominated compounds can pose health and environmental risks. Overall, terephthalic acid mono(2-bromoethyl) ester serves as a versatile intermediate in organic chemistry and materials science.
Formula:C10H9BrO4
InChI:InChI=1/C10H9BrO4/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4H,5-6H2,(H,12,13)
InChI key:SQFCKVQQFAJQCM-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)O)C(=O)OCCBr
Synonyms:- 2-Bromoethyl hydrogen terephthalate
- 4-[(2-Bromoethoxy)Carbonyl]Benzoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Terephthalic Acid Mono(2-bromoethyl) Ester
CAS:Controlled ProductFormula:C10H9BrO4Color and Shape:NeatMolecular weight:273.08

