CAS 173604-87-0
:(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate
Description:
(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate is a chemical compound characterized by its unique structure, which includes a dioxole ring, a carbonate functional group, and a nitrophenyl moiety. This compound typically exhibits properties associated with both organic carbonates and nitro compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group. The dioxole ring contributes to its stability and may influence its reactivity in various chemical reactions, including nucleophilic substitutions. The presence of the nitrophenyl group can enhance the compound's electronic properties, making it useful in applications such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H9NO8
InChI:InChI=1S/C12H9NO8/c1-7-10(21-12(15)19-7)6-18-11(14)20-9-4-2-8(3-5-9)13(16)17/h2-5H,6H2,1H3
InChI key:InChIKey=MZGIKNSLLFWGKL-UHFFFAOYSA-N
SMILES:C(OC(OC1=CC=C(N(=O)=O)C=C1)=O)C=2OC(=O)OC2C
Synonyms:- (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl p-nitrophenyl carbonate
- (5-Methyl-2-oxo-1,3-dioxol-4-yl)methylp-nitrophenyl carbonate
- Carbonic acid, (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl -ester
- (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate
CAS:(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonateFormula:C12H9NO8Purity:97%Molecular weight:295.2(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate
CAS:Formula:C12H9NO8Purity:97%Color and Shape:SolidMolecular weight:295.2018(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate
CAS:(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonateFormula:C12H9NO8Purity:97%Molecular weight:295.2(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate
CAS:(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate is a fine chemical that is used as a building block for the synthesis of complex compounds. It is an intermediate in the synthesis of 3,4-Dihydroquinazolinone. This compound has been reported to have useful pharmacological activity and has been used as a research chemical and in the synthesis of pharmaceuticals. (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4 nitrophenyl carbonate also has potential as a reagent and can be used in organic synthesis.Formula:C12H9NO8Purity:Min. 95%Color and Shape:White PowderMolecular weight:295.2 g/mol(5-METHYL-2-OXO-1,3-DIOXOL-4-YL)METHYL 4-NITROPHENYL CARBONATE
CAS:Purity:97%Molecular weight:295.2030029Ref: 10-F859810
Discontinued product




