CAS 174-78-7
:2-oxa-6-azaspiro[3.3]heptane
Description:
2-Oxa-6-azaspiro[3.3]heptane, with the CAS number 174-78-7, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom and an oxygen atom incorporated into its framework. This compound features a seven-membered ring system that includes both a nitrogen atom (making it an azaspiro compound) and an oxygen atom (making it an oxa compound). The presence of these heteroatoms contributes to its potential reactivity and interactions in various chemical environments. Typically, compounds of this nature may exhibit properties such as moderate solubility in polar solvents and potential biological activity, making them of interest in medicinal chemistry and materials science. The spiro configuration can influence the compound's stereochemistry and conformational flexibility, which are important factors in its chemical behavior and potential applications. Overall, 2-oxa-6-azaspiro[3.3]heptane represents a class of compounds that can be explored for various synthetic and functional applications in organic chemistry.
Formula:C5H9NO
InChI:InChI=1/C5H9NO/c1-5(2-6-1)3-7-4-5/h6H,1-4H2
SMILES:C1C2(CN1)COC2
Synonyms:- 2-Oxa-6-azaspiro[3.3]heptan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Oxa-6-azaspiro[3.3]heptane
CAS:Formula:C5H9NOPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:99.132-Oxa-6-azaspiro[3.3]heptane
CAS:2-Oxa-6-azaspiro[3.3]heptaneFormula:C5H9NOPurity:99%Color and Shape: colourless to light yellow liquidMolecular weight:99.13g/mol2-Oxa-6-azaspiro[3.3]heptane
CAS:Formula:C5H9NOPurity:95%Color and Shape:Liquid, ClearMolecular weight:99.1332-Oxa-6-azaspiro[3.3]heptane
CAS:2-Oxa-6-azaspiro[3.3]heptane is a drug that has been shown to have a strong affinity for the α7 nicotinic acetylcholine receptor (α7nAChR), which is found in high concentrations in the central nervous system. It also has been shown to stimulate epidermal growth factor receptor (EGFR) and anti-inflammatory activities. These properties make it a potential candidate for use as an analgesic, antipsychotic, and anti-inflammatory agent. The safety of this compound has been confirmed by a molecular modeling study and its pharmacokinetic properties have been characterized in rats. 2-Oxa-6-azaspiro[3.3]heptane is currently being evaluated as an analgesic in clinical trials involving patients with chronic pain due to cancer or other diseases.
Formula:C5H9NOPurity:Min. 95%Molecular weight:99.13 g/mol2-oxa-6-azaspiro[3.3]heptane
CAS:Formula:C5H9NOPurity:98%Color and Shape:LiquidMolecular weight:99.1311






