CAS 17407-56-6
:(-)-2-Hydroxy-3-methylbutyric acid
Description:
(-)-2-Hydroxy-3-methylbutyric acid, also known as HMB (beta-hydroxy-beta-methylbutyrate), is a branched-chain fatty acid derivative that is commonly studied for its potential benefits in muscle metabolism and recovery. It is a colorless to pale yellow liquid at room temperature and is soluble in water, which facilitates its use in various formulations. The compound is characterized by its hydroxyl (-OH) and carboxylic acid (-COOH) functional groups, contributing to its acidic properties. HMB is produced in the body from the amino acid leucine and is known for its role in protein synthesis and muscle preservation, particularly during periods of stress or intense exercise. It has garnered attention in nutritional and sports science for its potential to enhance muscle mass and strength, reduce muscle breakdown, and improve recovery times. Additionally, (-)-2-Hydroxy-3-methylbutyric acid is often available as a dietary supplement, and its safety profile is generally considered favorable when used appropriately.
Formula:C5H10O3
InChI:InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t4-/m1/s1
InChI key:InChIKey=NGEWQZIDQIYUNV-SCSAIBSYSA-N
SMILES:[C@@H](C(C)C)(C(O)=O)O
Synonyms:- Butanoic acid, 2-hydroxy-3-methyl-, (2R)-
- Butyric acid, 2-hydroxy-3-methyl-, D-
- (2R)-2-Hydroxy-3-methylbutanoic acid
- D-α-Hydroxyisovaleric acid
- Butanoic acid, 2-hydroxy-3-methyl-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
D-α-Hydroxyisovaleric acid
CAS:Bachem ID: 4001785.
Formula:C5H10O3Purity:> 99%Color and Shape:Light Yellow Crystalline PowderMolecular weight:118.13Butanoic acid, 2-hydroxy-3-methyl-, (2R)-
CAS:Formula:C5H10O3Purity:97%Color and Shape:SolidMolecular weight:118.1311(2R)-2-Hydroxy-3-methylbutanoic acid
CAS:(2R)-2-Hydroxy-3-methylbutanoic acidFormula:C5H10O3Purity:98%Molecular weight:118.13109(R)-2-Hydroxy-3-methylbutanoic Acid
CAS:Formula:C5H10O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:118.13(2R)-2-Hydroxy-3-methylbutanoic acid
CAS:Formula:C5H10O3Purity:96%Color and Shape:SolidMolecular weight:118.132D-alpha-Hydroxyisovaleric acid
CAS:D-alpha-Hydroxyisovaleric acid is a compound that is used to synthesize stereoisomers. It is also a component of supramolecular chemistry and has been used in the construction of supramolecular polymers. D-alpha-Hydroxyisovaleric acid can be found in some plants, such as valinomycin, isovaleric acid, and metarhizium. This stereoisomer can be synthetized from the hydroxy group and an amino acid or peptide. D-alpha-Hydroxyisovaleric acid has the ability to degrade nonribosomal peptides into smaller molecules through its hydrolytic properties. It also inhibits Verticillium dahliae, which causes wilt disease in plants, by inhibiting the synthesis of hydroxycarboxylates. D-alpha-Hydroxyisovaleric acid is biodegradable and can be used for industrial purposes as well as pharmaceuticals.Formula:C5H10O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:118.13 g/mol





