CAS 17422-32-1
:5-Chloroindole
Description:
5-Chloroindole is an organic compound characterized by the presence of a chlorine atom at the 5-position of the indole ring system. Indole itself is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The introduction of the chlorine atom influences the compound's reactivity and properties, making it a valuable intermediate in organic synthesis and medicinal chemistry. 5-Chloroindole is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its chemical structure allows for various substitution reactions, making it useful in the synthesis of pharmaceuticals and agrochemicals. Additionally, compounds related to indole, including 5-chloroindole, are often studied for their biological activities, including potential anti-cancer and anti-inflammatory properties. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 5-chloroindole serves as an important building block in the development of various chemical entities.
Formula:C8H6ClN
InChI:InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H
InChI key:InChIKey=MYTGFBZJLDLWQG-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1)NC=C2
Synonyms:- 1H-Indole, 5-chloro-
- 1H-Indole,5-chloro-(9CI)
- 5-chloro-1H-indole
- Indole, 5-chloro-
- NSC 89562
- 5-Chloroindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Chloroindole
CAS:Formula:C8H6ClNPurity:>98.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:151.595-Chloro-1H-indole
CAS:5-Chloro-1H-indoleFormula:C8H6ClNPurity:97%Color and Shape:SolidMolecular weight:151.59294Ref: IN-DA001ZIL
1g19.00€5g25.00€10g40.00€25g70.00€50g110.00€100g167.00€250g287.00€500g506.00€1kg986.00€5kg5,081.00€5-Chloroindole
CAS:5-Chloroindole is a molecule that can bind to the CB2 cannabinoid receptor. It has been shown in experiments to be an allosteric modulator of this receptor. 5-Chloroindole has been found to have an inhibitory effect on degenerative diseases, such as Huntington's disease and Alzheimer's disease, and may have therapeutic potential for these disorders. 5-Chloroindole binds to a metal surface by forming hydrogen bonds with the oxygen atom of its carboxyl group and the metal surface. The nucleophilic nature of 5-chloroindole allows it to react with chloride ions present in solution. 5-Chloroindole reacts with the carbon source in tissue culture, which leads to receptor activity and inhibition of cell proliferation.
Formula:C8H6ClNColor and Shape:White PowderMolecular weight:151.59 g/mol





