CAS 17447-60-8
:2-Vinylcyclopropane-1,1-dicarboxylic acid dimethyl ester
Description:
2-Vinylcyclopropane-1,1-dicarboxylic acid dimethyl ester, with the CAS number 17447-60-8, is an organic compound characterized by its unique structure, which includes a vinyl group and a cyclopropane ring. This compound features two carboxylic acid groups that are esterified with methyl groups, resulting in dimethyl ester functionality. It is typically a colorless to pale yellow liquid with a relatively low boiling point, indicating volatility. The presence of the vinyl group suggests that it can participate in various polymerization reactions, making it useful in the synthesis of polymers and copolymers. The cyclopropane ring contributes to its strain energy, which can influence its reactivity. Additionally, the compound may exhibit properties such as solubility in organic solvents and potential reactivity under specific conditions, including heat or the presence of catalysts. Its applications may extend to fields such as materials science, organic synthesis, and potentially in the development of specialty chemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-4-6-5-9(6,7(10)12-2)8(11)13-3/h4,6H,1,5H2,2-3H3
InChI key:BTHUKAQVHWDTAH-UHFFFAOYSA-N
SMILES:COC(=O)C1(CC1C=C)C(=O)OC
Synonyms:- dimethyl 2-vinylcyclopropane-1,1-dicarboxylate
- 2-Vinylcyclopropane-1,1-dicarboxylic acid dimethyl ester
- 1,1-Cyclopropanedicarboxylic acid, 2-ethenyl-, 1,1-dimethyl ester
- 1,1-Dimethyl 2-Ethenylcyclopropane-1,1-dicarboxylate
- Dimethyl 2-ethenylcyclopropane-1,1-dicarboxylate, 95%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl 2-vinylcyclopropane-1,1-dicarboxylate
CAS:Dimethyl 2-vinylcyclopropane-1,1-dicarboxylateFormula:C9H12O4Purity:95% (stabilized with TBC)Molecular weight:184.19Dimethyl 2-vinylcyclopropane-1,1-dicarboxylate
CAS:Formula:C9H12O4Purity:95%Color and Shape:SolidMolecular weight:184.18921,1-Cyclopropanedicarboxylic acid, 2-ethenyl-, 1,1-dimethyl ester
CAS:Purity:95% (stabilized with TBC)Molecular weight:184.1909943Dimethyl 2-vinylcyclopropane-1,1-dicarboxylate
CAS:Dimethyl 2-vinylcyclopropane-1,1-dicarboxylateFormula:C9H12O4Purity:95% (stabilized with TBC)Molecular weight:184.191,1-Dimethyl 2-Ethenylcyclopropane-1,1-dicarboxylate
CAS:Controlled ProductApplications 1,1-Dimethyl 2-Ethenylcyclopropane-1,1-dicarboxylate is a useful chemical in organic synthesis.
References Laugeois, Maxime, et al.: Org. Let., 19(9), 2266-2269 (2017);Zhu, Haipan, et al.: Beilstein J. of Org. Chem., 12, 1340-1347 (2016)Formula:C9H12O4Color and Shape:NeatMolecular weight:184.19




